C32H24O6 — CID 131971247
CID 131971247 (PubChem CID 131971247) has the molecular formula C32H24O6 and a molecular weight of 504.54 g/mol.
| Compound Name | CID 131971247 |
|---|---|
| PubChem CID | 131971247 |
| Molecular Formula | C32H24O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | — |
| SMILES | OC1[C@H]2OC3(O[C@H]2C(O)[C@@H]2OC4(O[C@@H]12)c1ccccc1-c1ccccc14)c1ccccc1-c1ccccc13 |
| InChI | InChI=1S/C32H24O6/c33-25-27-28(36-31(35-27)21-13-5-1-9-17(21)18-10-2-6-14-22(18)31)26(34)30-29(25)37-32(38-30)23-15-7-3-11-19(23)20-12-4-8-16-24(20)32/h1-16,25-30,33-34H/t25?,26?,27-,28-,29-,30+/m0/s1 |
| InChIKey | AFGWYPBHENITFO-CSXACLAXSA-N |
| XLogP | 4.05 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |