C19H16O2 — CID 102409270
(4R,6R)-4-ethynyl-6-methylspiro[1,3-dioxane-2,9'-fluorene] (PubChem CID 102409270) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (4R,6R)-4-ethynyl-6-methylspiro[1,3-dioxane-2,9'-fluorene].
| Compound Name | (4R,6R)-4-ethynyl-6-methylspiro[1,3-dioxane-2,9'-fluorene] |
|---|---|
| PubChem CID | 102409270 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (4R,6R)-4-ethynyl-6-methylspiro[1,3-dioxane-2,9'-fluorene] |
| SMILES | C#C[C@H]1C[C@@H](C)OC2(O1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C19H16O2/c1-3-14-12-13(2)20-19(21-14)17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h1,4-11,13-14H,12H2,2H3/t13-,14+/m1/s1 |
| InChIKey | XXUFTTIUNHFQEK-KGLIPLIRSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|