C24H24O8 — CID 3011491
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-(9H-fluoren-9-yloxy)oxan-3-yl] acetate (PubChem CID 3011491) has the molecular formula C24H24O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(9H-fluoren-9-yloxy)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(9H-fluoren-9-yloxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 3011491 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(9H-fluoren-9-yloxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC2c3ccccc3-c3ccccc32)OC[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H24O8/c1-13(25)29-20-12-28-24(23(31-15(3)27)22(20)30-14(2)26)32-21-18-10-6-4-8-16(18)17-9-5-7-11-19(17)21/h4-11,20-24H,12H2,1-3H3/t20-,22-,23+,24+/m1/s1 |
| InChIKey | ZHVVXQMCQUKHIP-AZOUXBGGSA-N |
| XLogP | 2.92 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|