C27H28O9 — CID 3011492
[(2R,3S,4S,5R,6R)-2,5-diacetyloxy-6-(9H-fluoren-9-yloxy)-3-prop-1-en-2-yloxyoxan-4-yl] acetate (PubChem CID 3011492) has the molecular formula C27H28O9 and a molecular weight of 496.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2,5-diacetyloxy-6-(9H-fluoren-9-yloxy)-3-prop-1-en-2-yloxyoxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-2,5-diacetyloxy-6-(9H-fluoren-9-yloxy)-3-prop-1-en-2-yloxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 3011492 |
| Molecular Formula | C27H28O9 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2,5-diacetyloxy-6-(9H-fluoren-9-yloxy)-3-prop-1-en-2-yloxyoxan-4-yl] acetate |
| SMILES | C=C(C)O[C@@H]1[C@@H](OC(C)=O)O[C@@H](OC2c3ccccc3-c3ccccc32)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H28O9/c1-14(2)31-24-23(32-15(3)28)25(33-16(4)29)27(36-26(24)34-17(5)30)35-22-20-12-8-6-10-18(20)19-11-7-9-13-21(19)22/h6-13,22-27H,1H2,2-5H3/t23-,24-,25+,26-,27+/m0/s1 |
| InChIKey | HMHSXHXQUGNHAS-UIPNDDLNSA-N |
| XLogP | 3.80 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|