C21H26O10 — CID 3797448
(3,4,5-triacetyloxy-6-phenylmethoxyoxan-2-yl)methyl acetate (PubChem CID 3797448) has the molecular formula C21H26O10 and a molecular weight of 438.43 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-phenylmethoxyoxan-2-yl)methyl acetate.
| Compound Name | (3,4,5-triacetyloxy-6-phenylmethoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 3797448 |
| Molecular Formula | C21H26O10 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (3,4,5-triacetyloxy-6-phenylmethoxyoxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OCc2ccccc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H26O10/c1-12(22)26-11-17-18(28-13(2)23)19(29-14(3)24)20(30-15(4)25)21(31-17)27-10-16-8-6-5-7-9-16/h5-9,17-21H,10-11H2,1-4H3 |
| InChIKey | XDMACMMTPGFUCZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|