C21H24 — CID 153440114
(2R,3R,4S,5S)-2,3,4,5-tetramethylspiro[cyclopentane-1,9'-fluorene] (PubChem CID 153440114) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2,3,4,5-tetramethylspiro[cyclopentane-1,9'-fluorene].
| Compound Name | (2R,3R,4S,5S)-2,3,4,5-tetramethylspiro[cyclopentane-1,9'-fluorene] |
|---|---|
| PubChem CID | 153440114 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (2R,3R,4S,5S)-2,3,4,5-tetramethylspiro[cyclopentane-1,9'-fluorene] |
| SMILES | C[C@@H]1[C@H](C)[C@H](C)C2(c3ccccc3-c3ccccc32)[C@@H]1C |
| InChI | InChI=1S/C21H24/c1-13-14(2)16(4)21(15(13)3)19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-16H,1-4H3/t13-,14+,15-,16+ |
| InChIKey | ASLIMGKWDRWRLS-GEEKYZPCSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |