About 3-methylspiro[azirine-2,9'-fluorene]
3-methylspiro[azirine-2,9'-fluorene] (PubChem CID 13480601) has the molecular formula C15H11N
and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-methylspiro[azirine-2,9'-fluorene].
Molecular Properties
| Compound Name | 3-methylspiro[azirine-2,9'-fluorene] |
| PubChem CID | 13480601 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-methylspiro[azirine-2,9'-fluorene] |
| SMILES | CC1=NC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C15H11N/c1-10-15(16-10)13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-9H,1H3 |
| InChIKey | WTGDUBVGOAUBFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylspiro[azirine-2,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[azirine-2,9'-fluorene]?
The IUPAC name of 3-methylspiro[azirine-2,9'-fluorene] (CID 13480601) is 3-methylspiro[azirine-2,9'-fluorene].
What is the SMILES notation for 3-methylspiro[azirine-2,9'-fluorene]?
The canonical SMILES for 3-methylspiro[azirine-2,9'-fluorene] is CC1=NC12c1ccccc1-c1ccccc12.
What is the InChIKey of 3-methylspiro[azirine-2,9'-fluorene]?
The InChIKey is WTGDUBVGOAUBFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N/c1-10-15(16-10)13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-9H,1H3.
What are the key properties of 3-methylspiro[azirine-2,9'-fluorene]?
3-methylspiro[azirine-2,9'-fluorene] has a molecular weight of 205.26 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[azirine-2,9'-fluorene] is sourced from PubChem (CID 13480601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).