C16H11ClO2 — CID 101474171
3-(chloromethyl)spiro[oxirane-2,10'-phenanthrene]-9'-one (PubChem CID 101474171) has the molecular formula C16H11ClO2 and a molecular weight of 270.71 g/mol. Its IUPAC name is 3-(chloromethyl)spiro[oxirane-2,10'-phenanthrene]-9'-one.
| Compound Name | 3-(chloromethyl)spiro[oxirane-2,10'-phenanthrene]-9'-one |
|---|---|
| PubChem CID | 101474171 |
| Molecular Formula | C16H11ClO2 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-(chloromethyl)spiro[oxirane-2,10'-phenanthrene]-9'-one |
| SMILES | O=C1c2ccccc2-c2ccccc2C12OC2CCl |
| InChI | InChI=1S/C16H11ClO2/c17-9-14-16(19-14)13-8-4-3-6-11(13)10-5-1-2-7-12(10)15(16)18/h1-8,14H,9H2 |
| InChIKey | DYMRSJDINJPGCO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|