C20H23FN+ — CID 123984092
8,8-diethyl-4-(fluoromethyl)-7-methylidene-6H-pyrido[2,1-a][2]benzazepin-5-ium (PubChem CID 123984092) has the molecular formula C20H23FN+ and a molecular weight of 296.41 g/mol. Its IUPAC name is 8,8-diethyl-4-(fluoromethyl)-7-methylidene-6H-pyrido[2,1-a][2]benzazepin-5-ium.
| Compound Name | 8,8-diethyl-4-(fluoromethyl)-7-methylidene-6H-pyrido[2,1-a][2]benzazepin-5-ium |
|---|---|
| PubChem CID | 123984092 |
| Molecular Formula | C20H23FN+ |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 8,8-diethyl-4-(fluoromethyl)-7-methylidene-6H-pyrido[2,1-a][2]benzazepin-5-ium |
| SMILES | C=C1C[n+]2c(CF)cccc2-c2ccccc2C1(CC)CC |
| InChI | InChI=1S/C20H23FN/c1-4-20(5-2)15(3)14-22-16(13-21)9-8-12-19(22)17-10-6-7-11-18(17)20/h6-12H,3-5,13-14H2,1-2H3/q+1 |
| InChIKey | ZXCQNEZJQZDZKS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|