C22H28N+ — CID 123670434
2-butan-2-yl-7,7-diethyl-6-methylidenebenzo[a]quinolizin-5-ium (PubChem CID 123670434) has the molecular formula C22H28N+ and a molecular weight of 306.47 g/mol. Its IUPAC name is 2-butan-2-yl-7,7-diethyl-6-methylidenebenzo[a]quinolizin-5-ium.
| Compound Name | 2-butan-2-yl-7,7-diethyl-6-methylidenebenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123670434 |
| Molecular Formula | C22H28N+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-butan-2-yl-7,7-diethyl-6-methylidenebenzo[a]quinolizin-5-ium |
| SMILES | C=C1[n+]2ccc(C(C)CC)cc2-c2ccccc2C1(CC)CC |
| InChI | InChI=1S/C22H28N/c1-6-16(4)18-13-14-23-17(5)22(7-2,8-3)20-12-10-9-11-19(20)21(23)15-18/h9-16H,5-8H2,1-4H3/q+1 |
| InChIKey | LARQBGDFBKNTBX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|