C18H18I2 — CID 142719764
2-(diiodomethyl)-9,9-diethylfluorene (PubChem CID 142719764) has the molecular formula C18H18I2 and a molecular weight of 488.15 g/mol. Its IUPAC name is 2-(diiodomethyl)-9,9-diethylfluorene.
| Compound Name | 2-(diiodomethyl)-9,9-diethylfluorene |
|---|---|
| PubChem CID | 142719764 |
| Molecular Formula | C18H18I2 |
| Molecular Weight | 488.15 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 2-(diiodomethyl)-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(C(I)I)cc21 |
| InChI | InChI=1S/C18H18I2/c1-3-18(4-2)15-8-6-5-7-13(15)14-10-9-12(17(19)20)11-16(14)18/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | XJAJSOFTCXLCFH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.15 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|