About 2-(diiodomethyl)-9,9-diethylfluorene
2-(diiodomethyl)-9,9-diethylfluorene (PubChem CID 142719764) has the molecular formula C18H18I2
and a molecular weight of 488.15 g/mol. Its IUPAC name is 2-(diiodomethyl)-9,9-diethylfluorene.
Molecular Properties
| Compound Name | 2-(diiodomethyl)-9,9-diethylfluorene |
| PubChem CID | 142719764 |
| Molecular Formula | C18H18I2 |
| Molecular Weight | 488.15 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 2-(diiodomethyl)-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(C(I)I)cc21 |
| InChI | InChI=1S/C18H18I2/c1-3-18(4-2)15-8-6-5-7-13(15)14-10-9-12(17(19)20)11-16(14)18/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | XJAJSOFTCXLCFH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.15 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(diiodomethyl)-9,9-diethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diiodomethyl)-9,9-diethylfluorene?
The IUPAC name of 2-(diiodomethyl)-9,9-diethylfluorene (CID 142719764) is 2-(diiodomethyl)-9,9-diethylfluorene.
What is the SMILES notation for 2-(diiodomethyl)-9,9-diethylfluorene?
The canonical SMILES for 2-(diiodomethyl)-9,9-diethylfluorene is CCC1(CC)c2ccccc2-c2ccc(C(I)I)cc21.
What is the InChIKey of 2-(diiodomethyl)-9,9-diethylfluorene?
The InChIKey is XJAJSOFTCXLCFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18I2/c1-3-18(4-2)15-8-6-5-7-13(15)14-10-9-12(17(19)20)11-16(14)18/h5-11,17H,3-4H2,1-2H3.
What are the key properties of 2-(diiodomethyl)-9,9-diethylfluorene?
2-(diiodomethyl)-9,9-diethylfluorene has a molecular weight of 488.15 g/mol, XLogP of 6.64, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diiodomethyl)-9,9-diethylfluorene is sourced from PubChem (CID 142719764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).