C25H32N+ — CID 123607172
7,7-diethyl-9,9,11,11-tetramethyl-6-methylidene-10H-indeno[5,6-a]quinolizin-5-ium (PubChem CID 123607172) has the molecular formula C25H32N+ and a molecular weight of 346.54 g/mol. Its IUPAC name is 7,7-diethyl-9,9,11,11-tetramethyl-6-methylidene-10H-indeno[5,6-a]quinolizin-5-ium.
| Compound Name | 7,7-diethyl-9,9,11,11-tetramethyl-6-methylidene-10H-indeno[5,6-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123607172 |
| Molecular Formula | C25H32N+ |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 7,7-diethyl-9,9,11,11-tetramethyl-6-methylidene-10H-indeno[5,6-a]quinolizin-5-ium |
| SMILES | C=C1[n+]2ccccc2-c2cc3c(cc2C1(CC)CC)C(C)(C)CC3(C)C |
| InChI | InChI=1S/C25H32N/c1-8-25(9-2)17(3)26-13-11-10-12-22(26)18-14-20-21(15-19(18)25)24(6,7)16-23(20,4)5/h10-15H,3,8-9,16H2,1-2,4-7H3/q+1 |
| InChIKey | ACILZWJANNNVCA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|