C25H32N+ — CID 123891970
10,10-diethyl-14,14,16,16-tetramethyl-11-azoniatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,8,12,17-heptaene (PubChem CID 123891970) has the molecular formula C25H32N+ and a molecular weight of 346.54 g/mol. Its IUPAC name is 10,10-diethyl-14,14,16,16-tetramethyl-11-azoniatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,8,12,17-heptaene.
| Compound Name | 10,10-diethyl-14,14,16,16-tetramethyl-11-azoniatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,8,12,17-heptaene |
|---|---|
| PubChem CID | 123891970 |
| Molecular Formula | C25H32N+ |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 10,10-diethyl-14,14,16,16-tetramethyl-11-azoniatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,8,12,17-heptaene |
| SMILES | CCC1(CC)C=Cc2ccccc2-c2cc3c(c[n+]21)C(C)(C)CC3(C)C |
| InChI | InChI=1S/C25H32N/c1-7-25(8-2)14-13-18-11-9-10-12-19(18)22-15-20-21(16-26(22)25)24(5,6)17-23(20,3)4/h9-16H,7-8,17H2,1-6H3/q+1 |
| InChIKey | JWKRUOIUEFWVNQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|