C29H34N+ — CID 123953483
3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),10,12(17),13,15-nonaene (PubChem CID 123953483) has the molecular formula C29H34N+ and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),10,12(17),13,15-nonaene.
| Compound Name | 3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),10,12(17),13,15-nonaene |
|---|---|
| PubChem CID | 123953483 |
| Molecular Formula | C29H34N+ |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),10,12(17),13,15-nonaene |
| SMILES | CCCCc1cc2c3c4[n+](ccc3c1)C(CC)(CC)C=Cc1cccc(c1-4)C2(C)C |
| InChI | InChI=1S/C29H34N/c1-6-9-11-20-18-22-15-17-30-27-25-21(14-16-29(30,7-2)8-3)12-10-13-23(25)28(4,5)24(19-20)26(22)27/h10,12-19H,6-9,11H2,1-5H3/q+1 |
| InChIKey | IAILNBDPAGAOTF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|