C35H44NO2+ — CID 123547255
4-[(3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12(17),13,15-octaen-11-yl)methoxy]pent-3-en-2-one (PubChem CID 123547255) has the molecular formula C35H44NO2+ and a molecular weight of 510.74 g/mol. Its IUPAC name is 4-[(3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12(17),13,15-octaen-11-yl)methoxy]pent-3-en-2-one.
| Compound Name | 4-[(3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12(17),13,15-octaen-11-yl)methoxy]pent-3-en-2-one |
|---|---|
| PubChem CID | 123547255 |
| Molecular Formula | C35H44NO2+ |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | 4-[(3-butyl-9,9-diethyl-20,20-dimethyl-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12(17),13,15-octaen-11-yl)methoxy]pent-3-en-2-one |
| SMILES | CCCCc1cc2c3c4[n+](ccc3c1)C(CC)(CC)CC(COC(C)=CC(C)=O)c1cccc(c1-4)C2(C)C |
| InChI | InChI=1S/C35H44NO2/c1-8-11-13-25-19-26-16-17-36-33-31(26)30(20-25)34(6,7)29-15-12-14-28(32(29)33)27(21-35(36,9-2)10-3)22-38-24(5)18-23(4)37/h12,14-20,27H,8-11,13,21-22H2,1-7H3/q+1 |
| InChIKey | IZBPUHMBKMRBGD-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|