C42H46N2+2 — CID 123972823
3'-butyl-9',9'-diethyl-10,20',20'-trimethylspiro[7H-benzo[a]quinolizin-5-ium-6,11'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene] (PubChem CID 123972823) has the molecular formula C42H46N2+2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 3'-butyl-9',9'-diethyl-10,20',20'-trimethylspiro[7H-benzo[a]quinolizin-5-ium-6,11'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene].
| Compound Name | 3'-butyl-9',9'-diethyl-10,20',20'-trimethylspiro[7H-benzo[a]quinolizin-5-ium-6,11'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene] |
|---|---|
| PubChem CID | 123972823 |
| Molecular Formula | C42H46N2+2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 3'-butyl-9',9'-diethyl-10,20',20'-trimethylspiro[7H-benzo[a]quinolizin-5-ium-6,11'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene] |
| SMILES | CCCCc1cc2c3c4[n+](ccc3c1)C(CC)(CC)CC1(Cc3ccc(C)cc3-c3cccc[n+]31)c1cccc(c1-4)C2(C)C |
| InChI | InChI=1S/C42H46N2/c1-7-10-14-29-24-30-20-22-44-39-37(30)35(25-29)40(5,6)33-15-13-16-34(38(33)39)42(27-41(44,8-2)9-3)26-31-19-18-28(4)23-32(31)36-17-11-12-21-43(36)42/h11-13,15-25H,7-10,14,26-27H2,1-6H3/q+2 |
| InChIKey | KWFJVZVTJWYMDO-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|