C33H46N+ — CID 123304383
11,16-dibutyl-3-(3-ethylpentan-3-yl)-8,8-dimethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene (PubChem CID 123304383) has the molecular formula C33H46N+ and a molecular weight of 456.74 g/mol. Its IUPAC name is 11,16-dibutyl-3-(3-ethylpentan-3-yl)-8,8-dimethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene.
| Compound Name | 11,16-dibutyl-3-(3-ethylpentan-3-yl)-8,8-dimethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 123304383 |
| Molecular Formula | C33H46N+ |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 11,16-dibutyl-3-(3-ethylpentan-3-yl)-8,8-dimethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
| SMILES | CCCCc1cc2c3c([n+](CCCC)ccc3c1)-c1c(C(CC)(CC)CC)cccc1C2(C)C |
| InChI | InChI=1S/C33H46N/c1-8-13-16-24-22-25-19-21-34(20-14-9-2)31-29(25)28(23-24)32(6,7)26-17-15-18-27(30(26)31)33(10-3,11-4)12-5/h15,17-19,21-23H,8-14,16,20H2,1-7H3/q+1 |
| InChIKey | KFNPYMQURHBGBU-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|