C27H36N+ — CID 123489768
6-butyl-2-ethyl-1-[2-(3-methylpentan-3-yl)phenyl]isoquinolin-2-ium (PubChem CID 123489768) has the molecular formula C27H36N+ and a molecular weight of 374.59 g/mol. Its IUPAC name is 6-butyl-2-ethyl-1-[2-(3-methylpentan-3-yl)phenyl]isoquinolin-2-ium.
| Compound Name | 6-butyl-2-ethyl-1-[2-(3-methylpentan-3-yl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 123489768 |
| Molecular Formula | C27H36N+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 6-butyl-2-ethyl-1-[2-(3-methylpentan-3-yl)phenyl]isoquinolin-2-ium |
| SMILES | CCCCc1ccc2c(-c3ccccc3C(C)(CC)CC)[n+](CC)ccc2c1 |
| InChI | InChI=1S/C27H36N/c1-6-10-13-21-16-17-23-22(20-21)18-19-28(9-4)26(23)24-14-11-12-15-25(24)27(5,7-2)8-3/h11-12,14-20H,6-10,13H2,1-5H3/q+1 |
| InChIKey | HROVRXPZOIBZOV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|