C32H32N2O2+2 — CID 123320543
12-butyl-18,18-diethyl-27-oxa-17,20-diazoniahexacyclo[17.8.0.02,7.08,17.09,14.020,25]heptacosa-1(19),2,4,6,8(17),9(14),10,12,15,20,22,24-dodecaen-26-one (PubChem CID 123320543) has the molecular formula C32H32N2O2+2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 12-butyl-18,18-diethyl-27-oxa-17,20-diazoniahexacyclo[17.8.0.02,7.08,17.09,14.020,25]heptacosa-1(19),2,4,6,8(17),9(14),10,12,15,20,22,24-dodecaen-26-one.
| Compound Name | 12-butyl-18,18-diethyl-27-oxa-17,20-diazoniahexacyclo[17.8.0.02,7.08,17.09,14.020,25]heptacosa-1(19),2,4,6,8(17),9(14),10,12,15,20,22,24-dodecaen-26-one |
|---|---|
| PubChem CID | 123320543 |
| Molecular Formula | C32H32N2O2+2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 12-butyl-18,18-diethyl-27-oxa-17,20-diazoniahexacyclo[17.8.0.02,7.08,17.09,14.020,25]heptacosa-1(19),2,4,6,8(17),9(14),10,12,15,20,22,24-dodecaen-26-one |
| SMILES | CCCCc1ccc2c3[n+](ccc2c1)C(CC)(CC)c1c(oc(=O)c2cccc[n+]12)-c1ccccc1-3 |
| InChI | InChI=1S/C32H32N2O2/c1-4-7-12-22-16-17-24-23(21-22)18-20-34-28(24)25-13-8-9-14-26(25)29-30(32(34,5-2)6-3)33-19-11-10-15-27(33)31(35)36-29/h8-11,13-21H,4-7,12H2,1-3H3/q+2 |
| InChIKey | AUIKTGZKELDEQI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 38.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|