About CID 58986761
CID 58986761 (PubChem CID 58986761) has the molecular formula C21H23N
and a molecular weight of 289.42 g/mol.
Molecular Properties
| Compound Name | CID 58986761 |
| PubChem CID | 58986761 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | — |
| SMILES | [CH2-][n+]1ccc2ccccc2c1-c1ccc(CCCC)cc1C |
| InChI | InChI=1S/C21H23N/c1-4-5-8-17-11-12-19(16(2)15-17)21-20-10-7-6-9-18(20)13-14-22(21)3/h6-7,9-15H,3-5,8H2,1-2H3 |
| InChIKey | QUYNOMIXLPDOAK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58986761 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58986761?
The IUPAC name of CID 58986761 (CID 58986761) is not available.
What is the SMILES notation for CID 58986761?
The canonical SMILES for CID 58986761 is [CH2-][n+]1ccc2ccccc2c1-c1ccc(CCCC)cc1C.
What is the InChIKey of CID 58986761?
The InChIKey is QUYNOMIXLPDOAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N/c1-4-5-8-17-11-12-19(16(2)15-17)21-20-10-7-6-9-18(20)13-14-22(21)3/h6-7,9-15H,3-5,8H2,1-2H3.
What are the key properties of CID 58986761?
CID 58986761 has a molecular weight of 289.42 g/mol, XLogP of 5.09, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58986761 is sourced from PubChem (CID 58986761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).