C27H32N+ — CID 123584763
8,8-diethyl-13-pentylisoquinolino[1,2-a][2]benzazepin-7-ium (PubChem CID 123584763) has the molecular formula C27H32N+ and a molecular weight of 370.56 g/mol. Its IUPAC name is 8,8-diethyl-13-pentylisoquinolino[1,2-a][2]benzazepin-7-ium.
| Compound Name | 8,8-diethyl-13-pentylisoquinolino[1,2-a][2]benzazepin-7-ium |
|---|---|
| PubChem CID | 123584763 |
| Molecular Formula | C27H32N+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 8,8-diethyl-13-pentylisoquinolino[1,2-a][2]benzazepin-7-ium |
| SMILES | CCCCCc1ccc2c(c1)-c1c3ccccc3cc[n+]1C(CC)(CC)C=C2 |
| InChI | InChI=1S/C27H32N/c1-4-7-8-11-21-14-15-23-16-18-27(5-2,6-3)28-19-17-22-12-9-10-13-24(22)26(28)25(23)20-21/h9-10,12-20H,4-8,11H2,1-3H3/q+1 |
| InChIKey | KFBAFQSNAGMYDU-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|