C25H26F8N+ — CID 123943510
6,6-diethyl-10,12-difluoro-2-pentyl-9,11-bis(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium (PubChem CID 123943510) has the molecular formula C25H26F8N+ and a molecular weight of 492.47 g/mol. Its IUPAC name is 6,6-diethyl-10,12-difluoro-2-pentyl-9,11-bis(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium.
| Compound Name | 6,6-diethyl-10,12-difluoro-2-pentyl-9,11-bis(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium |
|---|---|
| PubChem CID | 123943510 |
| Molecular Formula | C25H26F8N+ |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 6,6-diethyl-10,12-difluoro-2-pentyl-9,11-bis(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium |
| SMILES | CCCCCc1cc[n+]2c(c1)-c1c(F)c(C(F)(F)F)c(F)c(C(F)(F)F)c1C=CC2(CC)CC |
| InChI | InChI=1S/C25H26F8N/c1-4-7-8-9-15-11-13-34-17(14-15)18-16(10-12-23(34,5-2)6-3)19(24(28,29)30)22(27)20(21(18)26)25(31,32)33/h10-14H,4-9H2,1-3H3/q+1 |
| InChIKey | ZOFJRVCRSOICNH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|