C23H26F3N5+2 — CID 123757547
5-butyl-18,18-diethyl-15-(trifluoromethyl)-14,16,17-triaza-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,17]nonadeca-2(7),3,5,8(19),9,11,13,15-octaene (PubChem CID 123757547) has the molecular formula C23H26F3N5+2 and a molecular weight of 429.49 g/mol. Its IUPAC name is 5-butyl-18,18-diethyl-15-(trifluoromethyl)-14,16,17-triaza-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,17]nonadeca-2(7),3,5,8(19),9,11,13,15-octaene.
| Compound Name | 5-butyl-18,18-diethyl-15-(trifluoromethyl)-14,16,17-triaza-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,17]nonadeca-2(7),3,5,8(19),9,11,13,15-octaene |
|---|---|
| PubChem CID | 123757547 |
| Molecular Formula | C23H26F3N5+2 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 5-butyl-18,18-diethyl-15-(trifluoromethyl)-14,16,17-triaza-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,17]nonadeca-2(7),3,5,8(19),9,11,13,15-octaene |
| SMILES | CCCCc1cc[n+]2c(c1)-c1cccc3[n+]1C2C(CC)(CC)n1nc(C(F)(F)F)nc1-3 |
| InChI | InChI=1S/C23H26F3N5/c1-4-7-9-15-12-13-29-18(14-15)16-10-8-11-17-19-27-20(23(24,25)26)28-31(19)22(5-2,6-3)21(29)30(16)17/h8,10-14,21H,4-7,9H2,1-3H3/q+2 |
| InChIKey | WYOKEPZEGIWTOC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|