C24H34N+ — CID 91804385
10-butyl-6,7,7-triethyl-4-methyl-6H-benzo[a]quinolizin-5-ium (PubChem CID 91804385) has the molecular formula C24H34N+ and a molecular weight of 336.54 g/mol. Its IUPAC name is 10-butyl-6,7,7-triethyl-4-methyl-6H-benzo[a]quinolizin-5-ium.
| Compound Name | 10-butyl-6,7,7-triethyl-4-methyl-6H-benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 91804385 |
| Molecular Formula | C24H34N+ |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 10-butyl-6,7,7-triethyl-4-methyl-6H-benzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c(c1)-c1cccc(C)[n+]1C(CC)C2(CC)CC |
| InChI | InChI=1S/C24H34N/c1-6-10-13-19-15-16-21-20(17-19)22-14-11-12-18(5)25(22)23(7-2)24(21,8-3)9-4/h11-12,14-17,23H,6-10,13H2,1-5H3/q+1 |
| InChIKey | NFKHCYNAWOOQPJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|