C24H33FN+ — CID 123226875
10-butyl-6,6,7-triethyl-3-fluoro-7-methylbenzo[a]quinolizin-5-ium (PubChem CID 123226875) has the molecular formula C24H33FN+ and a molecular weight of 354.53 g/mol. Its IUPAC name is 10-butyl-6,6,7-triethyl-3-fluoro-7-methylbenzo[a]quinolizin-5-ium.
| Compound Name | 10-butyl-6,6,7-triethyl-3-fluoro-7-methylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123226875 |
| Molecular Formula | C24H33FN+ |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 10-butyl-6,6,7-triethyl-3-fluoro-7-methylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c(c1)-c1ccc(F)c[n+]1C(CC)(CC)C2(C)CC |
| InChI | InChI=1S/C24H33FN/c1-6-10-11-18-12-14-21-20(16-18)22-15-13-19(25)17-26(22)24(8-3,9-4)23(21,5)7-2/h12-17H,6-11H2,1-5H3/q+1 |
| InChIKey | RYPXCAGKSFYBKK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|