C25H34N+ — CID 123733438
10-butyl-6-ethenyl-6,7-diethyl-4,7-dimethylbenzo[a]quinolizin-5-ium (PubChem CID 123733438) has the molecular formula C25H34N+ and a molecular weight of 348.55 g/mol. Its IUPAC name is 10-butyl-6-ethenyl-6,7-diethyl-4,7-dimethylbenzo[a]quinolizin-5-ium.
| Compound Name | 10-butyl-6-ethenyl-6,7-diethyl-4,7-dimethylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123733438 |
| Molecular Formula | C25H34N+ |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 10-butyl-6-ethenyl-6,7-diethyl-4,7-dimethylbenzo[a]quinolizin-5-ium |
| SMILES | C=CC1(CC)[n+]2c(C)cccc2-c2cc(CCCC)ccc2C1(C)CC |
| InChI | InChI=1S/C25H34N/c1-7-11-14-20-16-17-22-21(18-20)23-15-12-13-19(5)26(23)25(9-3,10-4)24(22,6)8-2/h9,12-13,15-18H,3,7-8,10-11,14H2,1-2,4-6H3/q+1 |
| InChIKey | BDHTWJZVBNSCTB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|