C25H33NOP+ — CID 123753332
11-butyl-7-ethenyl-7,8-diethyl-8-methyl-5-phosphoroso-2H-azepino[2,1-a]isoquinolin-6-ium (PubChem CID 123753332) has the molecular formula C25H33NOP+ and a molecular weight of 394.52 g/mol. Its IUPAC name is 11-butyl-7-ethenyl-7,8-diethyl-8-methyl-5-phosphoroso-2H-azepino[2,1-a]isoquinolin-6-ium.
| Compound Name | 11-butyl-7-ethenyl-7,8-diethyl-8-methyl-5-phosphoroso-2H-azepino[2,1-a]isoquinolin-6-ium |
|---|---|
| PubChem CID | 123753332 |
| Molecular Formula | C25H33NOP+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 11-butyl-7-ethenyl-7,8-diethyl-8-methyl-5-phosphoroso-2H-azepino[2,1-a]isoquinolin-6-ium |
| SMILES | C=CC1(CC)[N+]2=C(P=O)C=CCC=C2c2cc(CCCC)ccc2C1(C)CC |
| InChI | InChI=1S/C25H33NOP/c1-6-10-13-19-16-17-21-20(18-19)22-14-11-12-15-23(28-27)26(22)25(8-3,9-4)24(21,5)7-2/h8,12,14-18H,3,6-7,9-11,13H2,1-2,4-5H3/q+1 |
| InChIKey | OCKGFKVNESCDOW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|