C32H36N+ — CID 91327153
11-butyl-6-ethenyl-6,7-diethyl-7-methylanthra[1,2-a]quinolizin-5-ium (PubChem CID 91327153) has the molecular formula C32H36N+ and a molecular weight of 434.65 g/mol. Its IUPAC name is 11-butyl-6-ethenyl-6,7-diethyl-7-methylanthra[1,2-a]quinolizin-5-ium.
| Compound Name | 11-butyl-6-ethenyl-6,7-diethyl-7-methylanthra[1,2-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 91327153 |
| Molecular Formula | C32H36N+ |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 11-butyl-6-ethenyl-6,7-diethyl-7-methylanthra[1,2-a]quinolizin-5-ium |
| SMILES | C=CC1(CC)[n+]2ccccc2-c2c(ccc3cc4c(CCCC)cccc4cc23)C1(C)CC |
| InChI | InChI=1S/C32H36N/c1-6-10-14-23-15-13-16-24-22-27-25(21-26(23)24)18-19-28-30(27)29-17-11-12-20-33(29)32(8-3,9-4)31(28,5)7-2/h8,11-13,15-22H,3,6-7,9-10,14H2,1-2,4-5H3/q+1 |
| InChIKey | BZSWKBNJQRQEQU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|