C26H30N+ — CID 123413121
6-ethenyl-6,7-diethyl-2,3,7-trimethylnaphtho[1,2-a]quinolizin-5-ium (PubChem CID 123413121) has the molecular formula C26H30N+ and a molecular weight of 356.53 g/mol. Its IUPAC name is 6-ethenyl-6,7-diethyl-2,3,7-trimethylnaphtho[1,2-a]quinolizin-5-ium.
| Compound Name | 6-ethenyl-6,7-diethyl-2,3,7-trimethylnaphtho[1,2-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123413121 |
| Molecular Formula | C26H30N+ |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 6-ethenyl-6,7-diethyl-2,3,7-trimethylnaphtho[1,2-a]quinolizin-5-ium |
| SMILES | C=CC1(CC)[n+]2cc(C)c(C)cc2-c2c(ccc3ccccc23)C1(C)CC |
| InChI | InChI=1S/C26H30N/c1-7-25(6)22-15-14-20-12-10-11-13-21(20)24(22)23-16-18(4)19(5)17-27(23)26(25,8-2)9-3/h8,10-17H,2,7,9H2,1,3-6H3/q+1 |
| InChIKey | ULPAZZURGYGTLU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|