C25H27FN+ — CID 123519733
6-ethenyl-5,6-diethyl-3-fluoro-2,5-dimethylisoquinolino[1,2-a]isoquinolin-7-ium (PubChem CID 123519733) has the molecular formula C25H27FN+ and a molecular weight of 360.50 g/mol. Its IUPAC name is 6-ethenyl-5,6-diethyl-3-fluoro-2,5-dimethylisoquinolino[1,2-a]isoquinolin-7-ium.
| Compound Name | 6-ethenyl-5,6-diethyl-3-fluoro-2,5-dimethylisoquinolino[1,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123519733 |
| Molecular Formula | C25H27FN+ |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 6-ethenyl-5,6-diethyl-3-fluoro-2,5-dimethylisoquinolino[1,2-a]isoquinolin-7-ium |
| SMILES | C=CC1(CC)[n+]2ccc3ccccc3c2-c2cc(C)c(F)cc2C1(C)CC |
| InChI | InChI=1S/C25H27FN/c1-6-24(5)21-16-22(26)17(4)15-20(21)23-19-12-10-9-11-18(19)13-14-27(23)25(24,7-2)8-3/h7,9-16H,2,6,8H2,1,3-5H3/q+1 |
| InChIKey | CXOQFMNUQXELFS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|