C28H29N2+ — CID 123781734
6-ethenyl-5,6-diethyl-5-methyl-12-phenylbenzimidazolo[2,1-a]isoquinolin-7-ium (PubChem CID 123781734) has the molecular formula C28H29N2+ and a molecular weight of 393.55 g/mol. Its IUPAC name is 6-ethenyl-5,6-diethyl-5-methyl-12-phenylbenzimidazolo[2,1-a]isoquinolin-7-ium.
| Compound Name | 6-ethenyl-5,6-diethyl-5-methyl-12-phenylbenzimidazolo[2,1-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123781734 |
| Molecular Formula | C28H29N2+ |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 6-ethenyl-5,6-diethyl-5-methyl-12-phenylbenzimidazolo[2,1-a]isoquinolin-7-ium |
| SMILES | C=CC1(CC)[n+]2c(n(-c3ccccc3)c3ccccc32)-c2ccccc2C1(C)CC |
| InChI | InChI=1S/C28H29N2/c1-5-27(4)23-18-12-11-17-22(23)26-29(21-15-9-8-10-16-21)24-19-13-14-20-25(24)30(26)28(27,6-2)7-3/h6,8-20H,2,5,7H2,1,3-4H3/q+1 |
| InChIKey | QGPQEUBYDYUDNI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|