C24H34N3+ — CID 123479657
1-cyclohexyl-5-ethenyl-5,6-diethyl-3,6-dimethyl-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium (PubChem CID 123479657) has the molecular formula C24H34N3+ and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-cyclohexyl-5-ethenyl-5,6-diethyl-3,6-dimethyl-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium.
| Compound Name | 1-cyclohexyl-5-ethenyl-5,6-diethyl-3,6-dimethyl-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123479657 |
| Molecular Formula | C24H34N3+ |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 1-cyclohexyl-5-ethenyl-5,6-diethyl-3,6-dimethyl-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium |
| SMILES | C=CC1(CC)[n+]2c(C)nn(C3CCCCC3)c2-c2ccccc2C1(C)CC |
| InChI | InChI=1S/C24H34N3/c1-6-23(5)21-17-13-12-16-20(21)22-26(24(23,7-2)8-3)18(4)25-27(22)19-14-10-9-11-15-19/h7,12-13,16-17,19H,2,6,8-11,14-15H2,1,3-5H3/q+1 |
| InChIKey | QNCYEHRDBWAAMX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|