C50H62N3+ — CID 123993210
12-(6-butyl-2,4-dicyclohexyl-9-methylcarbazol-3-yl)-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium (PubChem CID 123993210) has the molecular formula C50H62N3+ and a molecular weight of 705.07 g/mol. Its IUPAC name is 12-(6-butyl-2,4-dicyclohexyl-9-methylcarbazol-3-yl)-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium.
| Compound Name | 12-(6-butyl-2,4-dicyclohexyl-9-methylcarbazol-3-yl)-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123993210 |
| Molecular Formula | C50H62N3+ |
| Molecular Weight | 705.07 g/mol |
| Exact Mass | 704.49 |
| IUPAC Name | 12-(6-butyl-2,4-dicyclohexyl-9-methylcarbazol-3-yl)-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
| SMILES | CCCCc1ccc2c(c1)c1c(C3CCCCC3)c(-n3c4[n+](c5ccccc53)C(C)(CC)C(C)(CC)c3ccccc3-4)c(C3CCCCC3)cc1n2C |
| InChI | InChI=1S/C50H62N3/c1-7-10-21-34-30-31-41-39(32-34)46-44(51(41)6)33-38(35-22-13-11-14-23-35)47(45(46)36-24-15-12-16-25-36)52-42-28-19-20-29-43(42)53-48(52)37-26-17-18-27-40(37)49(4,8-2)50(53,5)9-3/h17-20,26-33,35-36H,7-16,21-25H2,1-6H3/q+1 |
| InChIKey | LQVUNWNNPFLYOJ-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.07 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|