C46H58N3+ — CID 123815500
12-[7-butyl-9-methyl-2,4-bis(2-methylpropyl)carbazol-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium (PubChem CID 123815500) has the molecular formula C46H58N3+ and a molecular weight of 652.99 g/mol. Its IUPAC name is 12-[7-butyl-9-methyl-2,4-bis(2-methylpropyl)carbazol-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium.
| Compound Name | 12-[7-butyl-9-methyl-2,4-bis(2-methylpropyl)carbazol-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123815500 |
| Molecular Formula | C46H58N3+ |
| Molecular Weight | 652.99 g/mol |
| Exact Mass | 652.46 |
| IUPAC Name | 12-[7-butyl-9-methyl-2,4-bis(2-methylpropyl)carbazol-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
| SMILES | CCCCc1ccc2c3c(CC(C)C)cc(CC(C)C)c(-n4c5[n+](c6ccccc64)C(C)(CC)C(C)(CC)c4ccccc4-5)c3n(C)c2c1 |
| InChI | InChI=1S/C46H58N3/c1-11-14-19-32-24-25-36-40(28-32)47(10)43-41(36)33(26-30(4)5)29-34(27-31(6)7)42(43)48-38-22-17-18-23-39(38)49-44(48)35-20-15-16-21-37(35)45(8,12-2)46(49,9)13-3/h15-18,20-25,28-31H,11-14,19,26-27H2,1-10H3/q+1 |
| InChIKey | ZRZQCOROZWQIMJ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.99 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|