C38H48N3+ — CID 123195981
5,6-diethyl-5,6-dimethyl-1-[9-methyl-1,3-bis(2-methylpropyl)carbazol-2-yl]imidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123195981) has the molecular formula C38H48N3+ and a molecular weight of 546.82 g/mol. Its IUPAC name is 5,6-diethyl-5,6-dimethyl-1-[9-methyl-1,3-bis(2-methylpropyl)carbazol-2-yl]imidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 5,6-diethyl-5,6-dimethyl-1-[9-methyl-1,3-bis(2-methylpropyl)carbazol-2-yl]imidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123195981 |
| Molecular Formula | C38H48N3+ |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | 5,6-diethyl-5,6-dimethyl-1-[9-methyl-1,3-bis(2-methylpropyl)carbazol-2-yl]imidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCC1(C)c2ccccc2-c2n(-c3c(CC(C)C)cc4c5ccccc5n(C)c4c3CC(C)C)cc[n+]2C1(C)CC |
| InChI | InChI=1S/C38H48N3/c1-10-37(7)32-18-14-12-17-29(32)36-40(20-21-41(36)38(37,8)11-2)34-27(22-25(3)4)24-30-28-16-13-15-19-33(28)39(9)35(30)31(34)23-26(5)6/h12-21,24-26H,10-11,22-23H2,1-9H3/q+1 |
| InChIKey | BFPXQDCVZOUQDC-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|