C30H29N2+ — CID 123917065
7-ethenyl-6-ethyl-6,7-dimethyl-1,2-diphenylpyrimido[6,1-a]isoquinolin-5-ium (PubChem CID 123917065) has the molecular formula C30H29N2+ and a molecular weight of 417.58 g/mol. Its IUPAC name is 7-ethenyl-6-ethyl-6,7-dimethyl-1,2-diphenylpyrimido[6,1-a]isoquinolin-5-ium.
| Compound Name | 7-ethenyl-6-ethyl-6,7-dimethyl-1,2-diphenylpyrimido[6,1-a]isoquinolin-5-ium |
|---|---|
| PubChem CID | 123917065 |
| Molecular Formula | C30H29N2+ |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 7-ethenyl-6-ethyl-6,7-dimethyl-1,2-diphenylpyrimido[6,1-a]isoquinolin-5-ium |
| SMILES | C=CC1(C)c2ccccc2-c2c(-c3ccccc3)c(-c3ccccc3)nc[n+]2C1(C)CC |
| InChI | InChI=1S/C30H29N2/c1-5-29(3)25-20-14-13-19-24(25)28-26(22-15-9-7-10-16-22)27(23-17-11-8-12-18-23)31-21-32(28)30(29,4)6-2/h5,7-21H,1,6H2,2-4H3/q+1 |
| InChIKey | CDJDEJZBIVYAFN-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|