C35H47N2O2+ — CID 123623531
7-ethyl-6-(4-methoxypent-2-en-2-yloxymethyl)-6,7-dimethyl-1-[4-(2-methylpentan-3-yl)phenyl]pyrazino[2,1-a]isoquinolin-5-ium (PubChem CID 123623531) has the molecular formula C35H47N2O2+ and a molecular weight of 527.77 g/mol. Its IUPAC name is 7-ethyl-6-(4-methoxypent-2-en-2-yloxymethyl)-6,7-dimethyl-1-[4-(2-methylpentan-3-yl)phenyl]pyrazino[2,1-a]isoquinolin-5-ium.
| Compound Name | 7-ethyl-6-(4-methoxypent-2-en-2-yloxymethyl)-6,7-dimethyl-1-[4-(2-methylpentan-3-yl)phenyl]pyrazino[2,1-a]isoquinolin-5-ium |
|---|---|
| PubChem CID | 123623531 |
| Molecular Formula | C35H47N2O2+ |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | 7-ethyl-6-(4-methoxypent-2-en-2-yloxymethyl)-6,7-dimethyl-1-[4-(2-methylpentan-3-yl)phenyl]pyrazino[2,1-a]isoquinolin-5-ium |
| SMILES | CCC(c1ccc(-c2ncc[n+]3c2-c2ccccc2C(C)(CC)C3(C)COC(C)=CC(C)OC)cc1)C(C)C |
| InChI | InChI=1S/C35H47N2O2/c1-10-29(24(3)4)27-16-18-28(19-17-27)32-33-30-14-12-13-15-31(30)34(7,11-2)35(8,37(33)21-20-36-32)23-39-26(6)22-25(5)38-9/h12-22,24-25,29H,10-11,23H2,1-9H3/q+1 |
| InChIKey | HWFWGRAAEDTMLO-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|