C29H36NO2+ — CID 91055532
8,8-diethyl-10-(4-methoxypent-3-en-2-yloxy)-10-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,12,14,16,18-octaene (PubChem CID 91055532) has the molecular formula C29H36NO2+ and a molecular weight of 430.61 g/mol. Its IUPAC name is 8,8-diethyl-10-(4-methoxypent-3-en-2-yloxy)-10-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,12,14,16,18-octaene.
| Compound Name | 8,8-diethyl-10-(4-methoxypent-3-en-2-yloxy)-10-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,12,14,16,18-octaene |
|---|---|
| PubChem CID | 91055532 |
| Molecular Formula | C29H36NO2+ |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 8,8-diethyl-10-(4-methoxypent-3-en-2-yloxy)-10-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,12,14,16,18-octaene |
| SMILES | CCC1(CC)CC(C)(OC(C)C=C(C)OC)[n+]2c(ccc3ccccc32)-c2ccccc21 |
| InChI | InChI=1S/C29H36NO2/c1-7-29(8-2)20-28(5,32-22(4)19-21(3)31-6)30-26-16-12-9-13-23(26)17-18-27(30)24-14-10-11-15-25(24)29/h9-19,22H,7-8,20H2,1-6H3/q+1 |
| InChIKey | IMTCSVQAGCTTLI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|