C17H22O3 — CID 11391688
4,4-diethyl-1-(1-methoxypropa-1,2-dienyl)-3H-isochromen-1-ol (PubChem CID 11391688) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4,4-diethyl-1-(1-methoxypropa-1,2-dienyl)-3H-isochromen-1-ol.
| Compound Name | 4,4-diethyl-1-(1-methoxypropa-1,2-dienyl)-3H-isochromen-1-ol |
|---|---|
| PubChem CID | 11391688 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4,4-diethyl-1-(1-methoxypropa-1,2-dienyl)-3H-isochromen-1-ol |
| SMILES | C=C=C(OC)C1(O)OCC(CC)(CC)c2ccccc21 |
| InChI | InChI=1S/C17H22O3/c1-5-15(19-4)17(18)14-11-9-8-10-13(14)16(6-2,7-3)12-20-17/h8-11,18H,1,6-7,12H2,2-4H3 |
| InChIKey | GEJCAIYXAUUCCH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|