C37H50NO2+ — CID 123163423
11-(4-butyl-2,6-dimethylphenyl)-8,8-diethyl-6-(4-methoxypent-3-en-2-yloxy)-1-methyl-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium (PubChem CID 123163423) has the molecular formula C37H50NO2+ and a molecular weight of 540.81 g/mol. Its IUPAC name is 11-(4-butyl-2,6-dimethylphenyl)-8,8-diethyl-6-(4-methoxypent-3-en-2-yloxy)-1-methyl-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium.
| Compound Name | 11-(4-butyl-2,6-dimethylphenyl)-8,8-diethyl-6-(4-methoxypent-3-en-2-yloxy)-1-methyl-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium |
|---|---|
| PubChem CID | 123163423 |
| Molecular Formula | C37H50NO2+ |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 11-(4-butyl-2,6-dimethylphenyl)-8,8-diethyl-6-(4-methoxypent-3-en-2-yloxy)-1-methyl-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium |
| SMILES | CCCCc1cc(C)c(-c2ccc3c(c2)-c2c(C)ccc[n+]2C(OC(C)C=C(C)OC)CC3(CC)CC)c(C)c1 |
| InChI | InChI=1S/C37H50NO2/c1-10-13-16-30-20-26(5)35(27(6)21-30)31-17-18-33-32(23-31)36-25(4)15-14-19-38(36)34(24-37(33,11-2)12-3)40-29(8)22-28(7)39-9/h14-15,17-23,29,34H,10-13,16,24H2,1-9H3/q+1 |
| InChIKey | NNDKLVYCWRXIHF-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|