C45H48N2O2+2 — CID 123622521
1-[4-ethyl-2-[2-[1-(4-ethyl-2-methylphenyl)isoquinolin-2-ium-2-yl]ethenyl]phenyl]-2-[2-(4-methoxypent-3-en-2-yloxy)ethyl]isoquinolin-2-ium (PubChem CID 123622521) has the molecular formula C45H48N2O2+2 and a molecular weight of 648.89 g/mol. Its IUPAC name is 1-[4-ethyl-2-[2-[1-(4-ethyl-2-methylphenyl)isoquinolin-2-ium-2-yl]ethenyl]phenyl]-2-[2-(4-methoxypent-3-en-2-yloxy)ethyl]isoquinolin-2-ium.
| Compound Name | 1-[4-ethyl-2-[2-[1-(4-ethyl-2-methylphenyl)isoquinolin-2-ium-2-yl]ethenyl]phenyl]-2-[2-(4-methoxypent-3-en-2-yloxy)ethyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 123622521 |
| Molecular Formula | C45H48N2O2+2 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | 1-[4-ethyl-2-[2-[1-(4-ethyl-2-methylphenyl)isoquinolin-2-ium-2-yl]ethenyl]phenyl]-2-[2-(4-methoxypent-3-en-2-yloxy)ethyl]isoquinolin-2-ium |
| SMILES | CCc1ccc(-c2c3ccccc3cc[n+]2C=Cc2cc(CC)ccc2-c2c3ccccc3cc[n+]2CCOC(C)C=C(C)OC)c(C)c1 |
| InChI | InChI=1S/C45H48N2O2/c1-7-35-17-19-40(32(3)29-35)44-41-15-11-9-13-37(41)21-24-46(44)26-23-39-31-36(8-2)18-20-43(39)45-42-16-12-10-14-38(42)22-25-47(45)27-28-49-34(5)30-33(4)48-6/h9-26,29-31,34H,7-8,27-28H2,1-6H3/q+2 |
| InChIKey | KNGNWQWRIJIDPM-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|