C32H42NO2+ — CID 91347039
6,6-diethyl-7-[2-(4-methoxy-4-methylpentan-2-yl)oxyethylidene]-8,10-dimethylisoquinolino[2,1-a]quinolin-5-ium (PubChem CID 91347039) has the molecular formula C32H42NO2+ and a molecular weight of 472.69 g/mol. Its IUPAC name is 6,6-diethyl-7-[2-(4-methoxy-4-methylpentan-2-yl)oxyethylidene]-8,10-dimethylisoquinolino[2,1-a]quinolin-5-ium.
| Compound Name | 6,6-diethyl-7-[2-(4-methoxy-4-methylpentan-2-yl)oxyethylidene]-8,10-dimethylisoquinolino[2,1-a]quinolin-5-ium |
|---|---|
| PubChem CID | 91347039 |
| Molecular Formula | C32H42NO2+ |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 6,6-diethyl-7-[2-(4-methoxy-4-methylpentan-2-yl)oxyethylidene]-8,10-dimethylisoquinolino[2,1-a]quinolin-5-ium |
| SMILES | CCC1(CC)C(=CCOC(C)CC(C)(C)OC)c2c(C)cc(C)cc2-c2ccc3ccccc3[n+]21 |
| InChI | InChI=1S/C32H42NO2/c1-9-32(10-2)27(17-18-35-24(5)21-31(6,7)34-8)30-23(4)19-22(3)20-26(30)29-16-15-25-13-11-12-14-28(25)33(29)32/h11-17,19-20,24H,9-10,18,21H2,1-8H3/q+1 |
| InChIKey | XHIHNIFJSFVCLK-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|