C22H24INO3 — CID 86160176
1-ethyl-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium iodide (PubChem CID 86160176) has the molecular formula C22H24INO3 and a molecular weight of 477.34 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium iodide.
| Compound Name | 1-ethyl-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium iodide |
|---|---|
| PubChem CID | 86160176 |
| Molecular Formula | C22H24INO3 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-ethyl-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium iodide |
| SMILES | CC[n+]1c(C=Cc2cc(OC)c(OC)cc2OC)ccc2ccccc21.[I-] |
| InChI | InChI=1S/C22H24NO3.HI/c1-5-23-18(12-10-16-8-6-7-9-19(16)23)13-11-17-14-21(25-3)22(26-4)15-20(17)24-2;/h6-15H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ASTVDVROMNIPHF-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|