C19H18NO2+ — CID 59595288
4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]benzene-1,2-diol (PubChem CID 59595288) has the molecular formula C19H18NO2+ and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 59595288 |
| Molecular Formula | C19H18NO2+ |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]benzene-1,2-diol |
| SMILES | CC[n+]1c(/C=C/c2ccc(O)c(O)c2)ccc2ccccc21 |
| InChI | InChI=1S/C19H17NO2/c1-2-20-16(11-9-15-5-3-4-6-17(15)20)10-7-14-8-12-18(21)19(22)13-14/h3-13,22H,2H2,1H3/p+1 |
| InChIKey | LXCGPHOGFVRKDT-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|