C25H29N2+ — CID 6139447
1-ethyl-2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]quinolin-1-ium (PubChem CID 6139447) has the molecular formula C25H29N2+ and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-ethyl-2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]quinolin-1-ium.
| Compound Name | 1-ethyl-2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]quinolin-1-ium |
|---|---|
| PubChem CID | 6139447 |
| Molecular Formula | C25H29N2+ |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-ethyl-2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]quinolin-1-ium |
| SMILES | CC[n+]1c(/C=C/c2ccc3c(c2)C(C)(C)C(C)N3C)ccc2ccccc21 |
| InChI | InChI=1S/C25H29N2/c1-6-27-21(15-13-20-9-7-8-10-23(20)27)14-11-19-12-16-24-22(17-19)25(3,4)18(2)26(24)5/h7-18H,6H2,1-5H3/q+1 |
| InChIKey | NMPCZDGIILYGQA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|