C23H23N2+ — CID 91468063
2-[2-(2,3-dimethylindolizin-1-yl)ethenyl]-1-ethylquinolin-1-ium (PubChem CID 91468063) has the molecular formula C23H23N2+ and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-[2-(2,3-dimethylindolizin-1-yl)ethenyl]-1-ethylquinolin-1-ium.
| Compound Name | 2-[2-(2,3-dimethylindolizin-1-yl)ethenyl]-1-ethylquinolin-1-ium |
|---|---|
| PubChem CID | 91468063 |
| Molecular Formula | C23H23N2+ |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-[2-(2,3-dimethylindolizin-1-yl)ethenyl]-1-ethylquinolin-1-ium |
| SMILES | CC[n+]1c(C=Cc2c(C)c(C)n3ccccc23)ccc2ccccc21 |
| InChI | InChI=1S/C23H23N2/c1-4-24-20(13-12-19-9-5-6-10-22(19)24)14-15-21-17(2)18(3)25-16-8-7-11-23(21)25/h5-16H,4H2,1-3H3/q+1 |
| InChIKey | MXFZSTJXSFUALJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|