C22H24NO3+ — CID 86160184
1-ethyl-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium (PubChem CID 86160184) has the molecular formula C22H24NO3+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium.
| Compound Name | 1-ethyl-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium |
|---|---|
| PubChem CID | 86160184 |
| Molecular Formula | C22H24NO3+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-ethyl-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinolin-1-ium |
| SMILES | CC[n+]1c(C=Cc2cc(OC)c(OC)c(OC)c2)ccc2ccccc21 |
| InChI | InChI=1S/C22H24NO3/c1-5-23-18(13-11-17-8-6-7-9-19(17)23)12-10-16-14-20(24-2)22(26-4)21(15-16)25-3/h6-15H,5H2,1-4H3/q+1 |
| InChIKey | PQIUJIACRBZQHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|