C25H23NO5S — CID 166450315
benzenesulfonate;2-methoxy-4-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol (PubChem CID 166450315) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is benzenesulfonate;2-methoxy-4-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol.
| Compound Name | benzenesulfonate;2-methoxy-4-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 166450315 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | benzenesulfonate;2-methoxy-4-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol |
| SMILES | COc1cc(C=Cc2ccc3ccccc3[n+]2C)ccc1O.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C19H17NO2.C6H6O3S/c1-20-16(11-9-15-5-3-4-6-17(15)20)10-7-14-8-12-18(21)19(13-14)22-2;7-10(8,9)6-4-2-1-3-5-6/h3-13H,1-2H3;1-5H,(H,7,8,9) |
| InChIKey | RMJKRWVJSXTUGW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|