C24H22O4 — CID 68818083
5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-naphthalen-2-ylpent-4-ene-1,3-dione (PubChem CID 68818083) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-naphthalen-2-ylpent-4-ene-1,3-dione.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-naphthalen-2-ylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 68818083 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-naphthalen-2-ylpent-4-ene-1,3-dione |
| SMILES | COc1cc(C=CC(=O)C(C)(C)C(=O)c2ccc3ccccc3c2)ccc1O |
| InChI | InChI=1S/C24H22O4/c1-24(2,22(26)13-9-16-8-12-20(25)21(14-16)28-3)23(27)19-11-10-17-6-4-5-7-18(17)15-19/h4-15,25H,1-3H3 |
| InChIKey | JCGSPDWRHPJDTM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|