C21H22O4 — CID 68815817
5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-(4-methylphenyl)pent-4-ene-1,3-dione (PubChem CID 68815817) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-(4-methylphenyl)pent-4-ene-1,3-dione.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-(4-methylphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 68815817 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethyl-1-(4-methylphenyl)pent-4-ene-1,3-dione |
| SMILES | COc1cc(C=CC(=O)C(C)(C)C(=O)c2ccc(C)cc2)ccc1O |
| InChI | InChI=1S/C21H22O4/c1-14-5-9-16(10-6-14)20(24)21(2,3)19(23)12-8-15-7-11-17(22)18(13-15)25-4/h5-13,22H,1-4H3 |
| InChIKey | JXRDEZYYQNGELL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|